2-(4-N-Ethylpiperazinyl)benzyl alcohol
Catalog No: FT-0603799
CAS No: 914349-49-8
- Chemical Name: 2-(4-N-Ethylpiperazinyl)benzyl alcohol
- Molecular Formula: C13H20N2O
- Molecular Weight: 220.31
- InChI Key: KRYOTUHYCVJRAS-UHFFFAOYSA-N
- InChI: InChI=1S/C13H20N2O/c1-2-14-7-9-15(10-8-14)13-6-4-3-5-12(13)11-16/h3-6,16H,2,7-11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [2-(4-Ethylpiperazin-1-yl)phenyl]methanol |
|---|---|
| Flash_Point: | 180.4ºC |
| Melting_Point: | N/A |
| FW: | 220.31100 |
| Density: | 1.079g/cm3 |
| CAS: | 914349-49-8 |
| Bolling_Point: | 364ºC at 760 mmHg |
| MF: | C13H20N2O |
| Density: | 1.079g/cm3 |
|---|---|
| LogP: | 1.32370 |
| Flash_Point: | 180.4ºC |
| Refractive_Index: | 1.557 |
| FW: | 220.31100 |
| PSA: | 26.71000 |
| MF: | C13H20N2O |
| Bolling_Point: | 364ºC at 760 mmHg |
| Exact_Mass: | 220.15800 |
| HS_Code: | 2933599090 |
|---|