![5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine (CAS: 900514-08-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0677981.png "5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine chemical structure")
5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0677981
CAS No: 900514-08-1
- Chemical Name: 5-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C7H4ClIN2
- Molecular Weight: 278.48
- InChI Key: LZTOGEVTAZHIFX-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4ClIN2/c8-4-1-5-6(9)3-11-7(5)10-2-4/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 278.478 |
| Density: | 2.2±0.1 g/cm3 |
| CAS: | 900514-08-1 |
| Bolling_Point: | N/A |
| Product_Name: | 5-Chloro-3-iodo-7-azaindole |
| Melting_Point: | 228-229ºC |
| Flash_Point: | N/A |
| MF: | C7H4ClIN2 |
| Melting_Point: | 228-229ºC |
|---|---|
| Density: | 2.2±0.1 g/cm3 |
| LogP: | 3.92 |
| Refractive_Index: | 1.785 |
| FW: | 278.478 |
| PSA: | 28.68000 |
| MF: | C7H4ClIN2 |
| Exact_Mass: | 277.910767 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)