4-Chlorophthalic acid
Catalog No: FT-0618255
CAS No: 89-20-3
- Chemical Name: 4-Chlorophthalic acid
- Molecular Formula: C8H5ClO4
- Molecular Weight: 200.57
- InChI Key: DVIPPHSQIBKWSA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5ClO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 285°C |
|---|---|
| CAS: | 89-20-3 |
| MF: | C8H5ClO4 |
| Flash_Point: | 195.4±23.7 °C |
| Product_Name: | 4-Chlorophthalic acid |
| Density: | 1.6±0.1 g/cm3 |
| FW: | 200.576 |
| Bolling_Point: | 399.5±27.0 °C at 760 mmHg |
| Refractive_Index: | 1.630 |
|---|---|
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Flash_Point: | 195.4±23.7 °C |
| LogP: | 1.98 |
| Bolling_Point: | 399.5±27.0 °C at 760 mmHg |
| Water_Solubility: | 0.1-0.5 g/100 mL at 21.5 ºC |
| FW: | 200.576 |
| PSA: | 74.60000 |
| Melting_Point: | 285°C |
| MF: | C8H5ClO4 |
| Exact_Mass: | 199.987640 |
| Density: | 1.6±0.1 g/cm3 |
| Safety_Statements: | S26-S36/37/39 |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2917399090 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
| WGK_Germany: | 3 |
Related Products
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-(3-hydroxy-5-methylphenoxy)oxane-3,4,5-triol