5-Bromo-7-fluoroindole
Catalog No: FT-0677004
CAS No: 883500-73-0
- Chemical Name: 5-Bromo-7-fluoroindole
- Molecular Formula: C8H5BrFN
- Molecular Weight: 214.03
- InChI Key: TZRRRWOVYVGRSL-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5BrFN/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 214.034 |
| Density: | 1.750±0.06 g/cm3 |
| CAS: | 883500-73-0 |
| Bolling_Point: | 315.1±22.0 °C at 760 mmHg |
| Product_Name: | 5-Bromo-7-fluoro-1H-indole |
| Melting_Point: | N/A |
| Flash_Point: | 144.3±22.3 °C |
| MF: | C8H5BrFN |
| Density: | 1.750±0.06 g/cm3 |
|---|---|
| LogP: | 3.04 |
| Flash_Point: | 144.3±22.3 °C |
| Water_Solubility: | Very slightly soluble (0.28 g/L) (25 ºC) |
| FW: | 214.034 |
| PSA: | 15.79000 |
| Exact_Mass: | 212.958939 |
| MF: | C8H5BrFN |
| Bolling_Point: | 315.1±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.680 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)