5-Chloro-2-iodopyrimidine
Catalog No: FT-0648738
CAS No: 874676-81-0
- Chemical Name: 5-Chloro-2-iodopyrimidine
- Molecular Formula: C4H2ClIN2
- Molecular Weight: 240.43
- InChI Key: BWDLBDLGVMLSCS-UHFFFAOYSA-N
- InChI: InChI=1S/C4H2ClIN2/c5-3-1-7-4(6)8-2-3/h1-2H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 240.430 |
| Density: | 2.2±0.1 g/cm3 |
| CAS: | 874676-81-0 |
| Bolling_Point: | 316.6±34.0 °C at 760 mmHg |
| Product_Name: | 5-Chloro-2-iodopyrimidine |
| Melting_Point: | N/A |
| Flash_Point: | 145.3±25.7 °C |
| MF: | C4H2ClIN2 |
| Density: | 2.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.96 |
| Flash_Point: | 145.3±25.7 °C |
| Refractive_Index: | 1.653 |
| FW: | 240.430 |
| PSA: | 25.78000 |
| MF: | C4H2ClIN2 |
| Bolling_Point: | 316.6±34.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 239.895111 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933599090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)