![[4-[(4-fluorophenyl)methoxy]phenyl]boronic acid (CAS: 871125-82-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0710910.png "[4-[(4-fluorophenyl)methoxy]phenyl]boronic acid chemical structure")
[4-[(4-fluorophenyl)methoxy]phenyl]boronic acid
Catalog No: FT-0710910
CAS No: 871125-82-5
- Chemical Name: [4-[(4-fluorophenyl)methoxy]phenyl]boronic acid
- Molecular Formula: C13H12BFO3
- Molecular Weight: 246.04
- InChI Key: HNQLLMVLGZJPJT-UHFFFAOYSA-N
- InChI: InChI=1S/C13H12BFO3/c15-12-5-1-10(2-6-12)9-18-13-7-3-11(4-8-13)14(16)17/h1-8,16-17H,9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 423.2ºC at 760 mmHg |
|---|---|
| CAS: | 871125-82-5 |
| MF: | C13H12BFO3 |
| Density: | 1.26g/cm3 |
| Melting_Point: | 165-170ºC |
| Product_Name: | [4-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| Flash_Point: | 209.7ºC |
| FW: | 246.04200 |
| Density: | 1.26g/cm3 |
|---|---|
| MF: | C13H12BFO3 |
| LogP: | 1.08450 |
| Melting_Point: | 165-170ºC |
| Exact_Mass: | 246.08600 |
| Bolling_Point: | 423.2ºC at 760 mmHg |
| Flash_Point: | 209.7ºC |
| FW: | 246.04200 |
| Refractive_Index: | 1.577 |
| PSA: | 49.69000 |
| RIDADR: | NONH for all modes of transport |
|---|
