![2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol (CAS: 870991-70-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0772707.png "2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol chemical structure")
2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol
Catalog No: FT-0772707
CAS No: 870991-70-1
- Chemical Name: 2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol
- Molecular Formula: C14H16N2O2
- Molecular Weight: 244.29
- InChI Key: MRNPLGLZBUDMRE-ZIAGYGMSSA-N
- InChI: InChI=1S/C14H16N2O2/c15-13(9-5-1-3-7-11(9)17)14(16)10-6-2-4-8-12(10)18/h1-8,13-14,17-18H,15-16H2/t13-,14-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 870991-70-1 |
|---|---|
| MF: | C14H16N2O2 |
| Density: | 1.294g/cm3 |
| Flash_Point: | 230.7ºC |
| Melting_Point: | 157-163ºC |
| Product_Name: | 2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol |
| Symbol: | GHS07 |
| Bolling_Point: | 457.9ºC at 760 mmHg |
| FW: | 244.28900 |
| Density: | 1.294g/cm3 |
|---|---|
| MF: | C14H16N2O2 |
| LogP: | 3.19820 |
| Melting_Point: | 157-163ºC |
| Exact_Mass: | 244.12100 |
| Bolling_Point: | 457.9ºC at 760 mmHg |
| Flash_Point: | 230.7ºC |
| FW: | 244.28900 |
| Refractive_Index: | 1.677 |
| PSA: | 92.50000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26-36/37 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | 22-36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)