methyl 4-(2-acetamidoethyl)benzoate
Catalog No: FT-0754832
CAS No: 870703-69-8
- Chemical Name: methyl 4-(2-acetamidoethyl)benzoate
- Molecular Formula: C12H15NO3
- Molecular Weight: 221.25
- InChI Key: NNHJGOJEUOUOFH-UHFFFAOYSA-N
- InChI: InChI=1S/C12H15NO3/c1-9(14)13-8-7-10-3-5-11(6-4-10)12(15)16-2/h3-6H,7-8H2,1-2H3,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 870703-69-8 |
|---|---|
| MF: | C12H15NO3 |
| Density: | 1.111g/cm3 |
| Flash_Point: | 211.2ºC |
| Melting_Point: | 89-93ºC |
| Product_Name: | Methyl 4-(2-acetamidoethyl)benzoate |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 425.6ºC at 760 mmHg |
| FW: | 221.25200 |
| Density: | 1.111g/cm3 |
|---|---|
| MF: | C12H15NO3 |
| LogP: | 1.99210 |
| Melting_Point: | 89-93ºC |
| Exact_Mass: | 221.10500 |
| Bolling_Point: | 425.6ºC at 760 mmHg |
| Flash_Point: | 211.2ºC |
| FW: | 221.25200 |
| Refractive_Index: | 1.519 |
| PSA: | 58.89000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS05, GHS07 |
| Safety_Statements: | 26-36/37/39 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| HS_Code: | 2924299090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 37/38-41 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)