![6-Bromo-imidazo[1,2-a]pyrimidine (CAS: 865156-68-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0646622.webp "6-Bromo-imidazo[1,2-a]pyrimidine chemical structure")
6-Bromo-imidazo[1,2-a]pyrimidine
Catalog No: FT-0646622
CAS No: 865156-68-9
- Chemical Name: 6-Bromo-imidazo[1,2-a]pyrimidine
- Molecular Formula: C6H4BrN3
- Molecular Weight: 198.02 g/mol
- InChI Key: BQMWMOQCMFLRQQ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4BrN3/c7-5-3-9-6-8-1-2-10(6)4-5/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 198.020 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 865156-68-9 |
| Bolling_Point: | 215-216ºC |
| Product_Name: | 6-Bromoimidazo[1,2-a]pyrimidine |
| Melting_Point: | 215-216ºC |
| Flash_Point: | N/A |
| MF: | C6H4BrN3 |
| Melting_Point: | 215-216ºC |
|---|---|
| Density: | 1.9±0.1 g/cm3 |
| LogP: | 1.33 |
| Refractive_Index: | 1.751 |
| FW: | 198.020 |
| PSA: | 30.19000 |
| MF: | C6H4BrN3 |
| Bolling_Point: | 215-216ºC |
| Exact_Mass: | 196.958847 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.webp "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.webp "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
