1-(2-Aminoethyl)cyclopentanol
Catalog No: FT-0683372
CAS No: 859629-83-7
- Chemical Name: 1-(2-Aminoethyl)cyclopentanol
- Molecular Formula: C7H15NO
- Molecular Weight: 129.20
- InChI Key: HRYBUTIAGJBDDV-UHFFFAOYSA-N
- InChI: InChI=1S/C7H15NO/c8-6-5-7(9)3-1-2-4-7/h9H,1-6,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 129.20000 |
| Density: | 1.03g/cm3 |
| CAS: | 859629-83-7 |
| Bolling_Point: | 216.835ºC at 760 mmHg |
| Product_Name: | 1-(2-aminoethyl)cyclopentan-1-ol |
| Melting_Point: | N/A |
| Flash_Point: | 84.939ºC |
| MF: | C7H15NO |
| Density: | 1.03g/cm3 |
|---|---|
| LogP: | 1.34060 |
| Flash_Point: | 84.939ºC |
| Refractive_Index: | 1.509 |
| FW: | 129.20000 |
| PSA: | 46.25000 |
| MF: | C7H15NO |
| Bolling_Point: | 216.835ºC at 760 mmHg |
| Exact_Mass: | 129.11500 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2922199090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)