Methyl 5-allyl-3-methoxysalicylate
Catalog No: FT-0642009
CAS No: 85614-43-3
- Chemical Name: Methyl 5-allyl-3-methoxysalicylate
- Molecular Formula: C12H14O4
- Molecular Weight: 222.24
- InChI Key: LYSUGZLJKRSLHM-UHFFFAOYSA-N
- InChI: InChI=1S/C12H14O4/c1-4-5-8-6-9(12(14)16-3)11(13)10(7-8)15-2/h4,6-7,13H,1,5H2,2-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 85614-43-3 |
| Flash_Point: | 119.8±21.4 °C |
| Product_Name: | Methyl 5-allyl-2-hydroxy-3-methoxybenzoate |
| Bolling_Point: | 324.1±42.0 °C at 760 mmHg |
| FW: | 222.237 |
| Melting_Point: | 54-58ºC |
| MF: | C12H14O4 |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.535 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 119.8±21.4 °C |
| LogP: | 2.93 |
| Bolling_Point: | 324.1±42.0 °C at 760 mmHg |
| FW: | 222.237 |
| PSA: | 55.76000 |
| Melting_Point: | 54-58ºC |
| MF: | C12H14O4 |
| Exact_Mass: | 222.089203 |
| Density: | 1.1±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22;R36/37/38 |
| HS_Code: | 2918990090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)