5-M-TOLYL-2H-PYRAZOL-3-YLAMINE
Catalog No: FT-0604330
CAS No: 80568-96-3
- Chemical Name: 5-M-TOLYL-2H-PYRAZOL-3-YLAMINE
- Molecular Formula: C10H11N3
- Molecular Weight: 173.21
- InChI Key: KRRSPSCILJPKSA-UHFFFAOYSA-N
- InChI: InChI=1S/C10H11N3/c1-7-3-2-4-8(5-7)9-6-10(11)13-12-9/h2-6H,1H3,(H3,11,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 173.214 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 80568-96-3 |
| Bolling_Point: | 430.2±33.0 °C at 760 mmHg |
| Product_Name: | 3-(3-methylphenyl)-1H-pyrazol-5-amine |
| Melting_Point: | 86-89ºC |
| Flash_Point: | 243.8±12.6 °C |
| MF: | C10H11N3 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.79 |
| Flash_Point: | 243.8±12.6 °C |
| Melting_Point: | 86-89ºC |
| FW: | 173.214 |
| PSA: | 54.70000 |
| Exact_Mass: | 173.095291 |
| MF: | C10H11N3 |
| Bolling_Point: | 430.2±33.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.644 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)