2-Aminohexadecanoic acid
Catalog No: FT-0636595
CAS No: 7769-79-1
- Chemical Name: 2-Aminohexadecanoic acid
- Molecular Formula: C16H33NO2
- Molecular Weight: 271.44
- InChI Key: XELWBYCKQCNAGY-UHFFFAOYSA-N
- InChI: InChI=1S/C16H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14,17H2,1H3,(H,18,19)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-Aminohexadecanoic acid |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 220ºC (dec.) |
| FW: | 271.43900 |
| Density: | 0.931 g/cm3 |
| CAS: | 7769-79-1 |
| Bolling_Point: | 392.6ºC at 760 mmHg |
| MF: | C16H33NO2 |
| Melting_Point: | 220ºC (dec.) |
|---|---|
| Density: | 0.931 g/cm3 |
| LogP: | 5.18980 |
| Refractive_Index: | 1.469 |
| FW: | 271.43900 |
| PSA: | 63.32000 |
| MF: | C16H33NO2 |
| Bolling_Point: | 392.6ºC at 760 mmHg |
| Exact_Mass: | 271.25100 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922499990 |
| Safety_Statements: | S22-S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)