3-Chloro-5-iodo-pyridine
Catalog No: FT-0678286
CAS No: 77332-90-2
- Chemical Name: 3-Chloro-5-iodo-pyridine
- Molecular Formula: C5H3ClIN
- Molecular Weight: 239.44
- InChI Key: JZMJGLPDACZKBC-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3ClIN/c6-4-1-5(7)3-8-2-4/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 239.44100 |
| Density: | 2.052g/cm3 |
| CAS: | 77332-90-2 |
| Bolling_Point: | 239.5ºC at 760 mmHg |
| Product_Name: | 3-chloro-5-iodopyridine |
| Melting_Point: | N/A |
| Flash_Point: | 98.6ºC |
| MF: | C5H3ClIN |
| Density: | 2.052g/cm3 |
|---|---|
| LogP: | 2.33960 |
| Flash_Point: | 98.6ºC |
| Refractive_Index: | 1.642 |
| FW: | 239.44100 |
| PSA: | 12.89000 |
| MF: | C5H3ClIN |
| Bolling_Point: | 239.5ºC at 760 mmHg |
| Exact_Mass: | 238.90000 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)