![5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid (CAS: 74929-17-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0771279.png "5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid chemical structure")
5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid
Catalog No: FT-0771279
CAS No: 74929-17-2
- Chemical Name: 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid
- Molecular Formula: C12H14N2O6
- Molecular Weight: 282.25
- InChI Key: SXXQCQDCWZFRGY-QMMMGPOBSA-N
- InChI: InChI=1S/C12H14N2O6/c13-8(12(19)20)2-4-10(16)14-6-1-3-9(15)7(5-6)11(17)18/h1,3,5,8,15H,2,4,13H2,(H,14,16)(H,17,18)(H,19,20)/t8-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 650.5ºC at 760 mmHg |
|---|---|
| CAS: | 74929-17-2 |
| MF: | C12H14N2O6 |
| Density: | 1.553g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid |
| Flash_Point: | 347.2ºC |
| FW: | 282.24900 |
| Density: | 1.553g/cm3 |
|---|---|
| MF: | C12H14N2O6 |
| LogP: | 0.99430 |
| Exact_Mass: | 282.08500 |
| Bolling_Point: | 650.5ºC at 760 mmHg |
| Flash_Point: | 347.2ºC |
| FW: | 282.24900 |
| Refractive_Index: | 1.675 |
| PSA: | 149.95000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| HS_Code: | 2924299090 |
| WGK_Germany: | 3 |
| RIDADR: | NONH for all modes of transport |
