4,5-Dimethylthiazole-2-carbaldehyde
Catalog No: FT-0698922
CAS No: 74531-15-0
- Chemical Name: 4,5-Dimethylthiazole-2-carbaldehyde
- Molecular Formula: C6H7NOS
- Molecular Weight: 141.19
- InChI Key: RRBIYJOEJILQJE-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7NOS/c1-4-5(2)9-6(3-8)7-4/h3H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 141.191 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 74531-15-0 |
| Bolling_Point: | 260.1±43.0 °C at 760 mmHg |
| Product_Name: | 4,5-Dimethylthiazole-2-carbaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | 111.1±28.2 °C |
| MF: | C6H7NOS |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.42 |
| Flash_Point: | 111.1±28.2 °C |
| Refractive_Index: | 1.588 |
| FW: | 141.191 |
| PSA: | 58.20000 |
| MF: | C6H7NOS |
| Bolling_Point: | 260.1±43.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 141.024841 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934100090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)