(3S)-3-Pyrrolidinecarboxylic acid
Catalog No: FT-0648202
CAS No: 72580-53-1
- Chemical Name: (3S)-3-Pyrrolidinecarboxylic acid
- Molecular Formula: C5H9NO2
- Molecular Weight: 115.13
- InChI Key: JAEIBKXSIXOLOL-BYPYZUCNSA-N
- InChI: InChI=1S/C5H9NO2/c7-5(8)4-1-2-6-3-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (S)-pyrrolidine-3-carboxylic acid |
|---|---|
| Flash_Point: | 106 ºC |
| Melting_Point: | N/A |
| FW: | 115.131 |
| Density: | 1.186 |
| CAS: | 72580-53-1 |
| Bolling_Point: | 252 ºC |
| MF: | C5H9NO2 |
| Density: | 1.186 |
|---|---|
| LogP: | -0.47 |
| Flash_Point: | 106 ºC |
| Refractive_Index: | 1.487 |
| FW: | 115.131 |
| PSA: | 49.33000 |
| MF: | C5H9NO2 |
| Bolling_Point: | 252 ºC |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Exact_Mass: | 115.063332 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)