2-Chloro-5-(difluoromethyl)pyridine
Catalog No: FT-0686351
CAS No: 71701-99-0
- Chemical Name: 2-Chloro-5-(difluoromethyl)pyridine
- Molecular Formula: C6H4ClF2N
- Molecular Weight: 163.55
- InChI Key: OSQYJPKSEWBNOE-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4ClF2N/c7-5-2-1-4(3-10-5)6(8)9/h1-3,6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 163.55200 |
| Density: | N/A |
| CAS: | 71701-99-0 |
| Bolling_Point: | N/A |
| Product_Name: | 2-Chloro-5-(difluoromethyl)pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 107 °C |
| MF: | C6H4ClF2N |
| LogP: | 2.67260 |
|---|---|
| PSA: | 12.89000 |
| MF: | C6H4ClF2N |
| FW: | 163.55200 |
| Exact_Mass: | 163.00000 |
| Flash_Point_(C): | 107 °C |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| Flash_Point_(F): | 224.6 °F |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)