2-METHYL-1,3-BENZOTHIAZOL-6-OL
Catalog No: FT-0646480
CAS No: 68867-18-5
- Chemical Name: 2-METHYL-1,3-BENZOTHIAZOL-6-OL
- Molecular Formula: C8H7NOS
- Molecular Weight: 165.21
- InChI Key: ROFBPPIQUBJMRO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7NOS/c1-5-9-7-3-2-6(10)4-8(7)11-5/h2-4,10H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 165.212 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 68867-18-5 |
| Bolling_Point: | 313.7±15.0 °C at 760 mmHg |
| Product_Name: | 2-METHYL-1,3-BENZOTHIAZOL-6-OL |
| Melting_Point: | N/A |
| Flash_Point: | 143.5±20.4 °C |
| MF: | C8H7NOS |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.67 |
| Flash_Point: | 143.5±20.4 °C |
| Refractive_Index: | 1.710 |
| FW: | 165.212 |
| PSA: | 61.36000 |
| MF: | C8H7NOS |
| Bolling_Point: | 313.7±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 165.024841 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934200090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)