2-Methylindoline
Catalog No: FT-0612877
CAS No: 6872-06-6
- Chemical Name: 2-Methylindoline
- Molecular Formula: C9H11N
- Molecular Weight: 133.19
- InChI Key: QRWRJDVVXAXGBT-UHFFFAOYSA-N
- InChI: InChI=1S/C9H11N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-5,7,10H,6H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 228-229 °C(lit.) |
|---|---|
| CAS: | 6872-06-6 |
| MF: | C9H11N |
| Melting_Point: | -51 °C |
| Symbol: | Warning |
| Density: | 1.023 g/mL at 25 °C(lit.) |
| FW: | 133.19000 |
| Product_Name: | 2-METHYL INDOLINE |
| Flash_Point: | 200 °F |
| Bolling_Point: | 228-229 °C(lit.) |
|---|---|
| LogP: | 2.18110 |
| Density: | 1.023 g/mL at 25 °C(lit.) |
| Melting_Point: | -51 °C |
| Exact_Mass: | 133.08900 |
| MF: | C9H11N |
| Refractive_Index: | n20/D 1.569(lit.) |
| Water_Solubility: | negligible |
| PSA: | 12.03000 |
| Flash_Point: | 200 °F |
| Molecular_Structure: | ['1. Molar refractive index 4187 ', '2. Molar volume 1345 ', '3. Parachor (902K)3255 ', '4. Surface tension 342 ', '5. Dielectric constant N/A ', '6. Polarizability 1659 ', '7. Single isotope mass 133089149 Da ', '8. Nominal mass 133 Da ', '9. Average mass 1331903 Da'] |
| FW: | 133.19000 |
| Safety_Statements: | H315-H319-H335 |
|---|---|
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
| Hazard_Codes: | Xn:Harmful |
| RTECS: | NM1926350 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22;R52/53 |
| Symbol: | Warning |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)