4-Chloro-7-methoxyquinoline
Catalog No: FT-0600677
CAS No: 68500-37-8
- Chemical Name: 4-Chloro-7-methoxyquinoline
- Molecular Formula: C10H8ClNO
- Molecular Weight: 193.63
- InChI Key: UKTYNFPTZDSBLR-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8ClNO/c1-13-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-6H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 68500-37-8 |
| Flash_Point: | 135.2±21.8 °C |
| Product_Name: | 4-Chloro-7-methoxyquinoline |
| Bolling_Point: | 299.9±20.0 °C at 760 mmHg |
| FW: | 193.630 |
| Melting_Point: | 75-77ºC |
| MF: | C10H8ClNO |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 75-77ºC |
|---|---|
| Refractive_Index: | 1.622 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C10H8ClNO |
| Flash_Point: | 135.2±21.8 °C |
| LogP: | 3.03 |
| FW: | 193.630 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 22.12000 |
| Bolling_Point: | 299.9±20.0 °C at 760 mmHg |
| Exact_Mass: | 193.029449 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933499090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P280-P301 + P312 + P330-P305 + P351 + P338 + P310 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)