![5-azabicyclo[2.2.1]hept-2-ene (CAS: 6671-85-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0721296.png "5-azabicyclo[2.2.1]hept-2-ene chemical structure")
5-azabicyclo[2.2.1]hept-2-ene
Catalog No: FT-0721296
CAS No: 6671-85-8
- Chemical Name: 5-azabicyclo[2.2.1]hept-2-ene
- Molecular Formula: C6H9N
- Molecular Weight: 95.14
- InChI Key: KPFWYFYRULFDQP-UHFFFAOYSA-N
- InChI: InChI=1S/C6H9N/c1-2-6-3-5(1)4-7-6/h1-2,5-7H,3-4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 95.14240 |
| CAS: | 6671-85-8 |
| MF: | C6H9N |
| Flash_Point: | N/A |
| Product_Name: | 2-Azabicyclo(2.2.1)hept-5-ene |
| Bolling_Point: | N/A |
| Density: | N/A |
| FW: | 95.14240 |
|---|---|
| PSA: | 12.03000 |
| MF: | C6H9N |
| Exact_Mass: | 95.07350 |
| LogP: | 0.86310 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2933990090 |
