(+/-)-threo-3-Methylglutamic Acid
Catalog No: FT-0671800
CAS No: 63088-04-0
- Molecular Formula: 161.16
- Formula Weight: C6H11NO4
- Inchl Key: FHJNAFIJPFGZRI-UHFFFAOYSA-N
- Inchl: InChI=1S/C6H11NO4/c1-3(2-4(8)9)5(7)6(10)11/h3,5H,2,7H2,1H3,(H,8,9)(H,10,11)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 161.15600 |
| Density: | 1.329g/cm3 |
| CAS: | 63088-04-0 |
| Bolling_Point: | 329.4ºC at 760 mmHg |
| Product_Name: | (+/-)-threo-3-Methylglutamic Acid |
| Melting_Point: | N/A |
| Flash_Point: | 153ºC |
| MF: | C6H11NO4 |
| Density: | 1.329g/cm3 |
|---|---|
| LogP: | 0.20940 |
| Flash_Point: | 153ºC |
| Refractive_Index: | 1.512 |
| FW: | 161.15600 |
| PSA: | 100.62000 |
| MF: | C6H11NO4 |
| Bolling_Point: | 329.4ºC at 760 mmHg |
| Exact_Mass: | 161.06900 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922499990 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)