(S)-6-(((Allyloxy)carbonyl)amino)-2-aminohexanoic acid
Catalog No: FT-0698710
CAS No: 6298-03-9
- Chemical Name: (S)-6-(((Allyloxy)carbonyl)amino)-2-aminohexanoic acid
- Molecular Formula: C10H18N2O4
- Molecular Weight: 230.26
- InChI Key: JMZPOGGPUVRZMI-QMMMGPOBSA-N
- InChI: InChI=1S/C10H18N2O4/c1-2-7-16-10(15)12-6-4-3-5-8(11)9(13)14/h2,8H,1,3-7,11H2,(H,12,15)(H,13,14)/t8-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | H-Lys(Alloc)-OH |
|---|---|
| Bolling_Point: | 414.9ºC at 760 mmHg |
| MF: | C10H18N2O4 |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| CAS: | 6298-03-9 |
| Density: | 1.153g/cm3 |
| FW: | 230.26100 |
| Flash_Point: | 204.7ºC |
| Exact_Mass: | 230.12700 |
|---|---|
| MF: | C10H18N2O4 |
| LogP: | 1.57200 |
| Bolling_Point: | 414.9ºC at 760 mmHg |
| Density: | 1.153g/cm3 |
| PSA: | 101.65000 |
| FW: | 230.26100 |
| Flash_Point: | 204.7ºC |
| Refractive_Index: | 1.498 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| HS_Code: | 2924199090 |
| Safety_Statements: | H317 |
| Warning_Statement: | P280 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)