O-Desmethyl Metoprolol
Catalog No: FT-0666173
CAS No: 62572-94-5
- Chemical Name: O-Desmethyl Metoprolol
- Molecular Formula: C14H23NO3
- Molecular Weight: 253.34
- InChI Key: CUKXSBOAIJILRY-UHFFFAOYSA-N
- InChI: InChI=1S/C14H23NO3/c1-11(2)15-9-13(17)10-18-14-5-3-12(4-6-14)7-8-16/h3-6,11,13,15-17H,7-10H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 62572-94-5 |
| Flash_Point: | 210.6ºC |
| Product_Name: | O-Desmethyl Metoprolol |
| Bolling_Point: | 424.6ºC at 760 mmHg |
| FW: | 253.33700 |
| Melting_Point: | 70-72ºC |
| MF: | C14H23NO3 |
| Density: | 1.085g/cm3 |
| Melting_Point: | 70-72ºC |
|---|---|
| Refractive_Index: | 1.531 |
| MF: | C14H23NO3 |
| Flash_Point: | 210.6ºC |
| LogP: | 1.35000 |
| FW: | 253.33700 |
| Density: | 1.085g/cm3 |
| PSA: | 61.72000 |
| Bolling_Point: | 424.6ºC at 760 mmHg |
| Exact_Mass: | 253.16800 |
| RTECS: | DA0512150 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)