2-Chlororesorcinol
Catalog No: FT-0601231
CAS No: 6201-65-6
- Chemical Name: 2-Chlororesorcinol
- Molecular Formula: C6H5ClO2
- Molecular Weight: 144.55
- InChI Key: SWZVJOLLQTWFCW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5ClO2/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 144.556 |
|---|---|
| CAS: | 6201-65-6 |
| Flash_Point: | 101.4±21.8 °C |
| MF: | C6H5ClO2 |
| Symbol: | Danger |
| Bolling_Point: | 244.1±20.0 °C at 760 mmHg |
| Melting_Point: | 94-99ºC |
| Product_Name: | 2-Chlororesorcinol |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 144.556 |
|---|---|
| MF: | C6H5ClO2 |
| Flash_Point: | 101.4±21.8 °C |
| Refractive_Index: | 1.629 |
| Bolling_Point: | 244.1±20.0 °C at 760 mmHg |
| PSA: | 40.46000 |
| Exact_Mass: | 143.997803 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| LogP: | 1.28 |
| Melting_Point: | 94-99ºC |
| Density: | 1.5±0.1 g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS05, GHS07 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
| Hazard_Codes: | Xn |
| HS_Code: | 2908199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)