![2-methylthieno[2,3-d][1,3]thiazole (CAS: 61612-02-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0739538.png "2-methylthieno[2,3-d][1,3]thiazole chemical structure")
2-methylthieno[2,3-d][1,3]thiazole
Catalog No: FT-0739538
CAS No: 61612-02-0
- Chemical Name: 2-methylthieno[2,3-d][1,3]thiazole
- Molecular Formula: C6H5NS2
- Molecular Weight: 155.2
- InChI Key: LYRYMIMXAYOASW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5NS2/c1-4-7-6-5(9-4)2-3-8-6/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 96-98ºC |
|---|---|
| CAS: | 61612-02-0 |
| MF: | C6H5NS2 |
| Density: | 1.385 |
| Melting_Point: | N/A |
| Product_Name: | 2-Methylthieno[2,3-d]thiazole |
| Flash_Point: | 101ºC |
| FW: | 155.24100 |
| Density: | 1.385 |
|---|---|
| MF: | C6H5NS2 |
| LogP: | 2.66620 |
| Exact_Mass: | 154.98600 |
| Bolling_Point: | 96-98ºC |
| Flash_Point: | 101ºC |
| FW: | 155.24100 |
| Refractive_Index: | 1.71 |
| PSA: | 69.37000 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)