![(2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid (CAS: 6027-15-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0770473.png "(2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid chemical structure")
(2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid
Catalog No: FT-0770473
CAS No: 6027-15-2
- Chemical Name: (2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid
- Molecular Formula: C8H16N2O4S2
- Molecular Weight: 268.4
- InChI Key: ZTVZLYBCZNMWCF-PHDIDXHHSA-N
- InChI: InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 507.58ºC at 760 mmHg |
|---|---|
| CAS: | 6027-15-2 |
| MF: | C8H16N2O4S2 |
| Density: | 1.444 g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | (2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid |
| Flash_Point: | 260.775ºC |
| FW: | 268.35400 |
| Density: | 1.444 g/cm3 |
|---|---|
| MF: | C8H16N2O4S2 |
| LogP: | 1.37240 |
| Exact_Mass: | 268.05500 |
| Bolling_Point: | 507.58ºC at 760 mmHg |
| Flash_Point: | 260.775ºC |
| FW: | 268.35400 |
| PSA: | 177.24000 |
| HS_Code: | 2930909090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-