cyclopropyl(piperazin-1-yl)methanone
Catalog No: FT-0694927
CAS No: 59878-57-8
- Chemical Name: cyclopropyl(piperazin-1-yl)methanone
- Molecular Formula: C8H14N2O
- Molecular Weight: 154.21
- InChI Key: KIALFUYSJAAJSU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H14N2O/c11-8(7-1-2-7)10-5-3-9-4-6-10/h7,9H,1-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 154.210 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 59878-57-8 |
| Bolling_Point: | 305.5±35.0 °C at 760 mmHg |
| Product_Name: | 1-(Cyclopropylcarbonyl)piperazine |
| Melting_Point: | N/A |
| Flash_Point: | 138.5±25.9 °C |
| MF: | C8H14N2O |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | -0.41 |
| Flash_Point: | 138.5±25.9 °C |
| Refractive_Index: | 1.535 |
| FW: | 154.210 |
| PSA: | 32.34000 |
| MF: | C8H14N2O |
| Bolling_Point: | 305.5±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 154.110611 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)