2-CHLORO-3-IODO-5-PICOLINE
Catalog No: FT-0652467
CAS No: 59782-91-1
- Chemical Name: 2-CHLORO-3-IODO-5-PICOLINE
- Molecular Formula: C6H5ClIN
- Molecular Weight: 253.47
- InChI Key: RBZFLTOFXAWOOQ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5ClIN/c1-4-2-5(8)6(7)9-3-4/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 253.468 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 59782-91-1 |
| Bolling_Point: | 284.1±35.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-3-iodo-5-methylpyridine |
| Melting_Point: | N/A |
| Flash_Point: | 125.6±25.9 °C |
| MF: | C6H5ClIN |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 3.19 |
| Flash_Point: | 125.6±25.9 °C |
| Refractive_Index: | 1.624 |
| FW: | 253.468 |
| PSA: | 12.89000 |
| MF: | C6H5ClIN |
| Bolling_Point: | 284.1±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 252.915512 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)