![2-[2-(2-CHLOROETHOXY)ETHYL]-1H-ISOINDOLE-1,3(2H)-DIONE (CAS: 58290-51-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0610852.png "2-[2-(2-CHLOROETHOXY)ETHYL]-1H-ISOINDOLE-1,3(2H)-DIONE chemical structure")
2-[2-(2-CHLOROETHOXY)ETHYL]-1H-ISOINDOLE-1,3(2H)-DIONE
Catalog No: FT-0610852
CAS No: 58290-51-0
- Molecular Formula: C12H12ClNO3
- Molecular Weight: 253.68
- InChI Key: DCWWMFNXTOGDNJ-UHFFFAOYSA-N
- InChI: InChI=1S/C12H12ClNO3/c13-5-7-17-8-6-14-11(15)9-3-1-2-4-10(9)12(14)16/h1-4H,5-8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-[2-(2-chloroethoxy)ethyl]isoindole-1,3-dione |
|---|---|
| Flash_Point: | 187.8ºC |
| Melting_Point: | 72ºC |
| FW: | 253.68200 |
| Density: | 1.328g/cm3 |
| CAS: | 58290-51-0 |
| Bolling_Point: | 386.9ºC at 760 mmHg |
| MF: | C12H12ClNO3 |
| Density: | 1.328g/cm3 |
|---|---|
| LogP: | 1.47590 |
| Flash_Point: | 187.8ºC |
| Melting_Point: | 72ºC |
| FW: | 253.68200 |
| PSA: | 46.61000 |
| Exact_Mass: | 253.05100 |
| MF: | C12H12ClNO3 |
| Bolling_Point: | 386.9ºC at 760 mmHg |
| Refractive_Index: | 1.572 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R34 |
| Safety_Statements: | S26-S36/37/39-S45 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)