11-Maleimidoundecanoic acid
Catalog No: FT-0604077
CAS No: 57079-01-3
- Chemical Name: 11-Maleimidoundecanoic acid
- Molecular Formula: C15H23NO4
- Molecular Weight: 281.35
- InChI Key: UVZTZBRGZXIBLZ-UHFFFAOYSA-N
- InChI: InChI=1S/C15H23NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h10-11H,1-9,12H2,(H,19,20)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 281.347 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 57079-01-3 |
| Bolling_Point: | 452.8±18.0 °C at 760 mmHg |
| Product_Name: | 11-(2,5-dioxopyrrol-1-yl)undecanoic acid |
| Melting_Point: | 89-90ºC |
| Flash_Point: | 227.6±21.2 °C |
| MF: | C15H23NO4 |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.36 |
| Flash_Point: | 227.6±21.2 °C |
| Melting_Point: | 89-90ºC |
| FW: | 281.347 |
| PSA: | 74.68000 |
| Exact_Mass: | 281.162720 |
| MF: | C15H23NO4 |
| Bolling_Point: | 452.8±18.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±2.4 mmHg at 25°C |
| Refractive_Index: | 1.515 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2925190090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)