3-(Dimethylaminomethyl)-7-azaindole
Catalog No: FT-0647191
CAS No: 5654-92-2
- Chemical Name: 3-(Dimethylaminomethyl)-7-azaindole
- Molecular Formula: C10H13N3
- Molecular Weight: 175.23
- InChI Key: RFLCFQLBXWLHKX-UHFFFAOYSA-N
- InChI: InChI=1S/C10H13N3/c1-13(2)7-8-6-12-10-9(8)4-3-5-11-10/h3-6H,7H2,1-2H3,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 175.23000 |
| Density: | 1.155g/cm3 |
| CAS: | 5654-92-2 |
| Bolling_Point: | 304.2ºC at 760mmHg |
| Product_Name: | 3-(DiMethylaMinoMethyl)-7-azaindole |
| Melting_Point: | 144-149ºC |
| Flash_Point: | 137.8ºC |
| MF: | C10H13N3 |
| Density: | 1.155g/cm3 |
|---|---|
| LogP: | 1.62450 |
| Flash_Point: | 137.8ºC |
| Melting_Point: | 144-149ºC |
| FW: | 175.23000 |
| PSA: | 31.92000 |
| Exact_Mass: | 175.11100 |
| MF: | C10H13N3 |
| Bolling_Point: | 304.2ºC at 760mmHg |
| Refractive_Index: | 1.643 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | 22-37/38-41 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)