6-methoxyquinoline-2-carbonitrile
Catalog No: FT-0714045
CAS No: 5467-79-8
- Chemical Name: 6-methoxyquinoline-2-carbonitrile
- Molecular Formula: C11H8N2O
- Molecular Weight: 184.19
- InChI Key: MOBUAKGGKVGTIE-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8N2O/c1-14-10-4-5-11-8(6-10)2-3-9(7-12)13-11/h2-6H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 5467-79-8 |
| Flash_Point: | 172.9ºC |
| Product_Name: | 6-methoxyquinoline-2-carbonitrile |
| Bolling_Point: | 362.2ºC at 760mmHg |
| FW: | 184.19400 |
| Melting_Point: | 175-179ºC |
| MF: | C11H8N2O |
| Density: | 1.23g/cm3 |
| Melting_Point: | 175-179ºC |
|---|---|
| FW: | 184.19400 |
| Refractive_Index: | 1.627 |
| MF: | C11H8N2O |
| Exact_Mass: | 184.06400 |
| LogP: | 2.11508 |
| Bolling_Point: | 362.2ºC at 760mmHg |
| Density: | 1.23g/cm3 |
| PSA: | 45.91000 |
| Flash_Point: | 172.9ºC |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
| Hazard_Codes: | Xn |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)