Metoclopramide hydrochloride
Catalog No: FT-0657870
CAS No: 54143-57-6
- Chemical Name: Metoclopramide hydrochloride
- Molecular Formula: C14H25Cl2N3O3
- Molecular Weight: 354.3
- InChI Key: KJBLQGHJOCAOJP-UHFFFAOYSA-N
- InChI: InChI=1S/C14H22ClN3O2.ClH.H2O/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H;1H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 336.257 |
| Density: | N/A |
| CAS: | 54143-57-6 |
| Bolling_Point: | 418.7ºC at 760mmHg |
| Product_Name: | metoclopramide hydrochloride |
| Melting_Point: | N/A |
| Flash_Point: | 207ºC |
| MF: | C14H23Cl2N3O2 |
| LogP: | 3.77650 |
|---|---|
| Flash_Point: | 207ºC |
| FW: | 336.257 |
| PSA: | 67.59000 |
| MF: | C14H23Cl2N3O2 |
| Bolling_Point: | 418.7ºC at 760mmHg |
| Exact_Mass: | 335.116730 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)