4-bromo-7-methoxy-2,3-dihydroinden-1-one
Catalog No: FT-0702721
CAS No: 5411-61-0
- Chemical Name: 4-bromo-7-methoxy-2,3-dihydroinden-1-one
- Molecular Formula: C10H9BrO2
- Molecular Weight: 241.08
- InChI Key: OJDMKCLDADYDRL-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9BrO2/c1-13-9-5-3-7(11)6-2-4-8(12)10(6)9/h3,5H,2,4H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 5411-61-0 |
| Flash_Point: | 176.8±27.9 °C |
| Product_Name: | 4-Bromo-7-methoxy-indan-1-one |
| Bolling_Point: | 368.8±42.0 °C at 760 mmHg |
| FW: | 241.081 |
| Melting_Point: | N/A |
| MF: | C10H9BrO2 |
| Density: | 1.6±0.1 g/cm3 |
| FW: | 241.081 |
|---|---|
| Refractive_Index: | 1.598 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C10H9BrO2 |
| Exact_Mass: | 239.978592 |
| LogP: | 3.49 |
| Bolling_Point: | 368.8±42.0 °C at 760 mmHg |
| Density: | 1.6±0.1 g/cm3 |
| PSA: | 26.30000 |
| Flash_Point: | 176.8±27.9 °C |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914700090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)