Hordenine
Catalog No: FT-0603459
CAS No: 539-15-1
- Chemical Name: Hordenine
- Molecular Formula: C10H15NO
- Molecular Weight: 165.23
- InChI Key: KUBCEEMXQZUPDQ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H15NO/c1-11(2)8-7-9-3-5-10(12)6-4-9/h3-6,12H,7-8H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 165.232 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 539-15-1 |
| Bolling_Point: | 270.2±23.0 °C at 760 mmHg |
| Product_Name: | Hordenine |
| Melting_Point: | N/A |
| Flash_Point: | 123.5±21.3 °C |
| MF: | C10H15NO |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | 1.40 |
| Flash_Point: | 123.5±21.3 °C |
| Refractive_Index: | 1.542 |
| FW: | 165.232 |
| PSA: | 23.47000 |
| MF: | C10H15NO |
| Bolling_Point: | 270.2±23.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 165.115356 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H317-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)