O-TOLUAMIDE
Catalog No: FT-0632302
CAS No: 527-85-5
- Chemical Name: O-TOLUAMIDE
- Molecular Formula: C8H9NO
- Molecular Weight: 135.16
- InChI Key: XXUNIGZDNWWYED-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9NO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H2,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 527-85-5 |
| Flash_Point: | 107.6ºC |
| Product_Name: | o-toluamide |
| Bolling_Point: | 254.3ºC at 760 mmHg |
| FW: | 135.16300 |
| Melting_Point: | 141-142ºC(lit.) |
| MF: | C8H9NO |
| Density: | 1.086 g/cm3 |
| Melting_Point: | 141-142ºC(lit.) |
|---|---|
| Refractive_Index: | 1.556 |
| MF: | C8H9NO |
| Flash_Point: | 107.6ºC |
| LogP: | 1.79420 |
| FW: | 135.16300 |
| Density: | 1.086 g/cm3 |
| PSA: | 43.09000 |
| Bolling_Point: | 254.3ºC at 760 mmHg |
| Exact_Mass: | 135.06800 |
| Symbol: | GHS07 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
| HS_Code: | 2924299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)