N-(2-Amino-4,5-dichlorophenyl)acetamide
Catalog No: FT-0683241
CAS No: 501076-48-8
- Chemical Name: N-(2-Amino-4,5-dichlorophenyl)acetamide
- Molecular Formula: C8H8Cl2N2O
- Molecular Weight: 219.06
- InChI Key: RFAVPISRRMQCOS-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8Cl2N2O/c1-4(13)12-8-3-6(10)5(9)2-7(8)11/h2-3H,11H2,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 219.06800 |
| Density: | 1.473g/cm3 |
| CAS: | 501076-48-8 |
| Bolling_Point: | 418.9ºC at 760 mmHg |
| Product_Name: | N-(2-Amino-4,5-dichlorophenyl)acetamide |
| Melting_Point: | 155-162ºC(lit.) |
| Flash_Point: | 207.2ºC |
| MF: | C8H8Cl2N2O |
| Density: | 1.473g/cm3 |
|---|---|
| LogP: | 3.18820 |
| Flash_Point: | 207.2ºC |
| Melting_Point: | 155-162ºC(lit.) |
| FW: | 219.06800 |
| PSA: | 55.12000 |
| Exact_Mass: | 218.00100 |
| MF: | C8H8Cl2N2O |
| Bolling_Point: | 418.9ºC at 760 mmHg |
| Refractive_Index: | 1.654 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | 22-36/37/38 |
| Safety_Statements: | 26-36/37 |
| Symbol: | Warning |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)