Caffeic acid
Catalog No: FT-0693125
CAS No: 501-16-6
- Chemical Name: Caffeic acid
- Molecular Formula: C9H8O4
- Molecular Weight: 180.16
- InChI Key: QAIPRVGONGVQAS-DUXPYHPUSA-N
- InChI: InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 180.157 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 501-16-6 |
| Bolling_Point: | 416.8±35.0 °C at 760 mmHg |
| Product_Name: | caffeic acid |
| Melting_Point: | 211-213ºC (dec.)(lit.) |
| Flash_Point: | 220.0±22.4 °C |
| MF: | C9H8O4 |
| LogP: | 1.42 |
|---|---|
| Flash_Point: | 220.0±22.4 °C |
| Refractive_Index: | 1.707 |
| FW: | 180.157 |
| Bolling_Point: | 416.8±35.0 °C at 760 mmHg |
| Melting_Point: | 211-213ºC (dec.)(lit.) |
| Density: | 1.5±0.1 g/cm3 |
| Water_Solubility: | ethanol: 50 mg/mL |
| PSA: | 77.76000 |
| MF: | C9H8O4 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 180.042252 |
| Hazard_Codes: | Xn: Harmful; |
|---|---|
| RTECS: | GD8950000 |
| Risk_Statements(EU): | 36/37/38-40-63-68 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| Warning_Statement: | P281-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918290000 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)