5-CHLORO-2'-DEOXYURIDINE
Catalog No: FT-0631215
CAS No: 50-90-8
- Chemical Name: 5-CHLORO-2'-DEOXYURIDINE
- Molecular Formula: C9H11ClN2O5
- Molecular Weight: 262.65
- InChI Key: NJCXGFKPQSFZIB-RRKCRQDMSA-N
- InChI: InChI=1S/C9H11ClN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 262.64700 |
|---|---|
| CAS: | 50-90-8 |
| Flash_Point: | N/A |
| MF: | C9H11ClN2O5 |
| Symbol: | Warning |
| Bolling_Point: | N/A |
| Melting_Point: | 176-179ºC |
| Product_Name: | 5-Chloro-2'-deoxyuridine |
| Density: | 1.67 g/cm3 |
| FW: | 262.64700 |
|---|---|
| MF: | C9H11ClN2O5 |
| Exact_Mass: | 262.03600 |
| Refractive_Index: | 1.644 |
| PSA: | 104.55000 |
| Melting_Point: | 176-179ºC |
| Density: | 1.67 g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | YU7400000 |
| Symbol: | GHS07, GHS08 |
| Warning_Statement: | P280 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R20/21/22 |
| Hazard_Codes: | Xn: Harmful; |
| Safety_Statements: | H302-H312-H332-H351 |
| HS_Code: | 2942000000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)