Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Catalog No: FT-0667343
CAS No: 43067-01-2
- Chemical Name: Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
- Molecular Formula: C17H18ClNO4
- Molecular Weight: 335.8
- InChI Key: REIGLQUFMMOAFU-UHFFFAOYSA-N
- InChI: InChI=1S/C17H18ClNO4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 335.782 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 43067-01-2 |
| Bolling_Point: | 436.7±45.0 °C at 760 mmHg |
| Product_Name: | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 217.9±28.7 °C |
| MF: | C17H18ClNO4 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 3.83 |
| Flash_Point: | 217.9±28.7 °C |
| Refractive_Index: | 1.546 |
| FW: | 335.782 |
| PSA: | 64.63000 |
| MF: | C17H18ClNO4 |
| Bolling_Point: | 436.7±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 335.092438 |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)