Methyl-2,3-O-isopropylidene-beta-D-ribofuranoside
Catalog No: FT-0635125
CAS No: 4099-85-8
- Molecular Formula: 204.22
- Formula Weight: C9H16O5
- Inchl Key: DXBHDBLZPXQALN-UHFFFAOYSA-N
- Inchl: InChI=1S/C9H16O5/c1-9(2)13-6-5(4-10)12-8(11-3)7(6)14-9/h5-8,10H,4H2,1-3H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 287.3±40.0 °C at 760 mmHg |
|---|---|
| MF: | C9H16O5 |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 204.220 |
| Product_Name: | ((3aR,4R,6R,6aR)-6-Methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methanol |
| CAS: | 4099-85-8 |
| Flash_Point: | 127.5±27.3 °C |
| Melting_Point: | N/A |
| Bolling_Point: | 287.3±40.0 °C at 760 mmHg |
|---|---|
| LogP: | 0.55 |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Exact_Mass: | 204.099777 |
| MF: | C9H16O5 |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.492 |
| Water_Solubility: | MISCIBLE |
| PSA: | 57.15000 |
| Flash_Point: | 127.5±27.3 °C |
| FW: | 204.220 |
| Safety_Statements: | S26-S37/39 |
|---|---|
| WGK_Germany: | 3 |
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
