2-Aminomethylphenylacetic acid
Catalog No: FT-0602766
CAS No: 40851-65-8
- Molecular Formula: 165.19
- Formula Weight: C9H11NO2
- Inchl Key: VLOIVYPDUSVCLZ-UHFFFAOYSA-N
- Inchl: InChI=1S/C9H11NO2/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4H,5-6,10H2,(H,11,12)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 239-240 °C(lit.) |
|---|---|
| CAS: | 40851-65-8 |
| MF: | C9H11NO2 |
| Flash_Point: | 152.2±22.3 °C |
| Product_Name: | [2-(Aminomethyl)phenyl]acetic acid |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 165.189 |
| Bolling_Point: | 328.0±22.0 °C at 760 mmHg |
| Refractive_Index: | 1.584 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 152.2±22.3 °C |
| LogP: | 0.55 |
| Bolling_Point: | 328.0±22.0 °C at 760 mmHg |
| FW: | 165.189 |
| PSA: | 63.32000 |
| Melting_Point: | 239-240 °C(lit.) |
| MF: | C9H11NO2 |
| Exact_Mass: | 165.078979 |
| Molecular_Structure: | ['1 . Molar refractive index 4581 ', '2 . Molar volume 1368 ', '3 . Parachor （902K）3715 ', '4 . Surface tension 542 ', '5 . Polarizability 1816'] |
| Density: | 1.2±0.1 g/cm3 |
| Safety_Statements: | S36-S24/25 |
|---|---|
| Hazard_Codes: | Xn |
| HS_Code: | 2942000000 |
| Risk_Statements(EU): | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| WGK_Germany: | 3 |
