N-Acetyl-L-asparagine
Catalog No: FT-0629829
CAS No: 4033-40-3
- Molecular Formula: 174.15
- Formula Weight: C6H10N2O4
- Inchl Key: HXFOXFJUNFFYMO-BYPYZUCNSA-N
- Inchl: InChI=1S/C6H10N2O4/c1-3(9)8-4(6(11)12)2-5(7)10/h4H,2H2,1H3,(H2,7,10)(H,8,9)(H,11,12)/t4-/m0/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 168-170ºC |
|---|---|
| CAS: | 4033-40-3 |
| MF: | C6H10N2O4 |
| Flash_Point: | 309.8±28.7 °C |
| Product_Name: | Na-Acetyl-L-asparagine |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 174.155 |
| Bolling_Point: | 588.7±45.0 °C at 760 mmHg |
| Refractive_Index: | 1.508 |
|---|---|
| Vapor_Pressure: | 0.0±3.6 mmHg at 25°C |
| Flash_Point: | 309.8±28.7 °C |
| LogP: | -1.84 |
| Bolling_Point: | 588.7±45.0 °C at 760 mmHg |
| FW: | 174.155 |
| PSA: | 109.49000 |
| Melting_Point: | 168-170ºC |
| MF: | C6H10N2O4 |
| Exact_Mass: | 174.064056 |
| Density: | 1.3±0.1 g/cm3 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Safety_Statements: | S22-S24/25 |
| HS_Code: | 2924199090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)