![[3-(Phenylcarbamoyl)phenyl]boronic acid (CAS: 397843-71-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0690170.png "[3-(Phenylcarbamoyl)phenyl]boronic acid chemical structure")
[3-(Phenylcarbamoyl)phenyl]boronic acid
Catalog No: FT-0690170
CAS No: 397843-71-9
- Chemical Name: [3-(Phenylcarbamoyl)phenyl]boronic acid
- Molecular Formula: C13H12BNO3
- Molecular Weight: 241.05
- InChI Key: ZFEJFNWZHUMGRH-UHFFFAOYSA-N
- InChI: InChI=1S/C13H12BNO3/c16-13(15-12-7-2-1-3-8-12)10-5-4-6-11(9-10)14(17)18/h1-9,17-18H,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | [3-(Phenylcarbamoyl)phenyl]boronic acid |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 250-260ºC |
| FW: | 241.050 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 397843-71-9 |
| Bolling_Point: | N/A |
| MF: | C13H12BNO3 |
| Refractive_Index: | 1.623 |
|---|---|
| Density: | 1.3±0.1 g/cm3 |
| LogP: | 1.99 |
| Melting_Point: | 250-260ºC |
| FW: | 241.050 |
| PSA: | 69.56000 |
| MF: | C13H12BNO3 |
| Exact_Mass: | 241.091019 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| HS_Code: | 2931900090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)