2-Chloro-3-nitrobenzoic acid
Catalog No: FT-0611733
CAS No: 3970-35-2
- Chemical Name: 2-Chloro-3-nitrobenzoic acid
- Molecular Formula: C7H4ClNO4
- Molecular Weight: 201.56
- InChI Key: JRQDVRIQJJPHEQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4ClNO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-Chloro-3-nitrobenzoic acid |
|---|---|
| Bolling_Point: | 359.9±27.0 °C at 760 mmHg |
| MF: | C7H4ClNO4 |
| Symbol: | GHS07 |
| Melting_Point: | 183-187 °C(lit.) |
| CAS: | 3970-35-2 |
| Density: | 1.6±0.1 g/cm3 |
| FW: | 201.564 |
| Flash_Point: | 171.5±23.7 °C |
| MF: | C7H4ClNO4 |
|---|---|
| Bolling_Point: | 359.9±27.0 °C at 760 mmHg |
| Exact_Mass: | 200.982880 |
| Melting_Point: | 183-187 °C(lit.) |
| PSA: | 83.12000 |
| Flash_Point: | 171.5±23.7 °C |
| Refractive_Index: | 1.628 |
| Density: | 1.6±0.1 g/cm3 |
| FW: | 201.564 |
| LogP: | 1.76 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 2942000000 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Hazard_Codes: | Xi:Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)