5-Chloro-2-methoxypyrimidine
Catalog No: FT-0688694
CAS No: 38373-44-3
- Chemical Name: 5-Chloro-2-methoxypyrimidine
- Molecular Formula: C5H5ClN2O
- Molecular Weight: 144.56
- InChI Key: GJNGJHZIOYFEOP-UHFFFAOYSA-N
- InChI: InChI=1S/C5H5ClN2O/c1-9-5-7-2-4(6)3-8-5/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 38373-44-3 |
| Flash_Point: | 95.6±25.1 °C |
| Product_Name: | 5-Chloro-2-methoxypyrimidine |
| Bolling_Point: | 234.5±32.0 °C at 760 mmHg |
| FW: | 144.559 |
| Melting_Point: | N/A |
| MF: | C5H5ClN2O |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.520 |
|---|---|
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| MF: | C5H5ClN2O |
| Flash_Point: | 95.6±25.1 °C |
| LogP: | 1.04 |
| FW: | 144.559 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 35.01000 |
| Bolling_Point: | 234.5±32.0 °C at 760 mmHg |
| Exact_Mass: | 144.009033 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933599090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)