Clorprenaline
Catalog No: FT-0635025
CAS No: 3811-25-4
- Chemical Name: Clorprenaline
- Molecular Formula: C11H16ClNO
- Molecular Weight: 213.7
- InChI Key: SSMSBSWKLKKXGG-UHFFFAOYSA-N
- InChI: InChI=1S/C11H16ClNO/c1-8(2)13-7-11(14)9-5-3-4-6-10(9)12/h3-6,8,11,13-14H,7H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3811-25-4 |
| Flash_Point: | 153.2±23.7 °C |
| Product_Name: | clorprenaline |
| Bolling_Point: | 329.7±27.0 °C at 760 mmHg |
| FW: | 213.704 |
| Melting_Point: | N/A |
| MF: | C11H16ClNO |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.537 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C11H16ClNO |
| Flash_Point: | 153.2±23.7 °C |
| LogP: | 2.18 |
| FW: | 213.704 |
| Density: | 1.1±0.1 g/cm3 |
| PSA: | 32.26000 |
| Bolling_Point: | 329.7±27.0 °C at 760 mmHg |
| Exact_Mass: | 213.092041 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2922199090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)