Isoquinoline-5-boronic acid
Catalog No: FT-0603963
CAS No: 371766-08-4
- Chemical Name: Isoquinoline-5-boronic acid
- Molecular Formula: C9H8BNO2
- Molecular Weight: 172.98
- InChI Key: XKEYHBLSCGBBGU-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8BNO2/c12-10(13)9-3-1-2-7-6-11-5-4-8(7)9/h1-6,12-13H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 166-188ºC |
|---|---|
| CAS: | 371766-08-4 |
| MF: | C9H8BNO2 |
| Flash_Point: | 207.3±26.5 °C |
| Product_Name: | Isoquinoline-5-boronicacid |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 172.976 |
| Bolling_Point: | 419.1±37.0 °C at 760 mmHg |
| Melting_Point: | 166-188ºC |
|---|---|
| Refractive_Index: | 1.645 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| MF: | C9H8BNO2 |
| Flash_Point: | 207.3±26.5 °C |
| LogP: | 1.33 |
| FW: | 172.976 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 53.35000 |
| Bolling_Point: | 419.1±37.0 °C at 760 mmHg |
| Exact_Mass: | 173.064804 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2933499090 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)